C14H21NO2S — CID 115170590
[2-(4-methoxy-3,5-dimethylphenyl)-2-methylpropyl]carbamothioic S-acid (PubChem CID 115170590) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is [2-(4-methoxy-3,5-dimethylphenyl)-2-methylpropyl]carbamothioic S-acid.
| Compound Name | [2-(4-methoxy-3,5-dimethylphenyl)-2-methylpropyl]carbamothioic S-acid |
|---|---|
| PubChem CID | 115170590 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | [2-(4-methoxy-3,5-dimethylphenyl)-2-methylpropyl]carbamothioic S-acid |
| SMILES | COc1c(C)cc(C(C)(C)CNC(=O)S)cc1C |
| InChI | InChI=1S/C14H21NO2S/c1-9-6-11(7-10(2)12(9)17-5)14(3,4)8-15-13(16)18/h6-7H,8H2,1-5H3,(H2,15,16,18) |
| InChIKey | KRJTZHBDJDCUBX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|