C17H19N3O7S — CID 11517105
4-(2-hydroxyethylcarbamoyl)-6-morpholin-4-ylsulfonylquinoline-3-carboxylic acid (PubChem CID 11517105) has the molecular formula C17H19N3O7S and a molecular weight of 409.42 g/mol. Its IUPAC name is 4-(2-hydroxyethylcarbamoyl)-6-morpholin-4-ylsulfonylquinoline-3-carboxylic acid.
| Compound Name | 4-(2-hydroxyethylcarbamoyl)-6-morpholin-4-ylsulfonylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 11517105 |
| Molecular Formula | C17H19N3O7S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 4-(2-hydroxyethylcarbamoyl)-6-morpholin-4-ylsulfonylquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cnc2ccc(S(=O)(=O)N3CCOCC3)cc2c1C(=O)NCCO |
| InChI | InChI=1S/C17H19N3O7S/c21-6-3-18-16(22)15-12-9-11(28(25,26)20-4-7-27-8-5-20)1-2-14(12)19-10-13(15)17(23)24/h1-2,9-10,21H,3-8H2,(H,18,22)(H,23,24) |
| InChIKey | VNPWRBGRKUELNW-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 146.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |