C10H8Cl2N2O2 — CID 115172025
1-cyano-N-(2,5-dichloro-4-methoxyphenyl)-N-methylformamide (PubChem CID 115172025) has the molecular formula C10H8Cl2N2O2 and a molecular weight of 259.09 g/mol. Its IUPAC name is 1-cyano-N-(2,5-dichloro-4-methoxyphenyl)-N-methylformamide.
| Compound Name | 1-cyano-N-(2,5-dichloro-4-methoxyphenyl)-N-methylformamide |
|---|---|
| PubChem CID | 115172025 |
| Molecular Formula | C10H8Cl2N2O2 |
| Molecular Weight | 259.09 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 1-cyano-N-(2,5-dichloro-4-methoxyphenyl)-N-methylformamide |
| SMILES | COc1cc(Cl)c(N(C)C(=O)C#N)cc1Cl |
| InChI | InChI=1S/C10H8Cl2N2O2/c1-14(10(15)5-13)8-3-7(12)9(16-2)4-6(8)11/h3-4H,1-2H3 |
| InChIKey | CPLAZERUMAXVGE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.09 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|