C9H8ClNO3 — CID 138585802
(5-chloro-2,4-dimethoxyphenyl) cyanate (PubChem CID 138585802) has the molecular formula C9H8ClNO3 and a molecular weight of 213.62 g/mol. Its IUPAC name is (5-chloro-2,4-dimethoxyphenyl) cyanate.
| Compound Name | (5-chloro-2,4-dimethoxyphenyl) cyanate |
|---|---|
| PubChem CID | 138585802 |
| Molecular Formula | C9H8ClNO3 |
| Molecular Weight | 213.62 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | (5-chloro-2,4-dimethoxyphenyl) cyanate |
| SMILES | COc1cc(OC)c(OC#N)cc1Cl |
| InChI | InChI=1S/C9H8ClNO3/c1-12-7-4-8(13-2)9(14-5-11)3-6(7)10/h3-4H,1-2H3 |
| InChIKey | CBHSXEAFAURULF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.62 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|