About (2-chloro-3,5-dimethoxy-6-methylphenyl) cyanate
(2-chloro-3,5-dimethoxy-6-methylphenyl) cyanate (PubChem CID 145348564) has the molecular formula C10H10ClNO3
and a molecular weight of 227.65 g/mol. Its IUPAC name is (2-chloro-3,5-dimethoxy-6-methylphenyl) cyanate.
Molecular Properties
| Compound Name | (2-chloro-3,5-dimethoxy-6-methylphenyl) cyanate |
| PubChem CID | 145348564 |
| Molecular Formula | C10H10ClNO3 |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | (2-chloro-3,5-dimethoxy-6-methylphenyl) cyanate |
| SMILES | COc1cc(OC)c(Cl)c(OC#N)c1C |
| InChI | InChI=1S/C10H10ClNO3/c1-6-7(13-2)4-8(14-3)9(11)10(6)15-5-12/h4H,1-3H3 |
| InChIKey | CRNHRKMQSSFINM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-3,5-dimethoxy-6-methylphenyl) cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-3,5-dimethoxy-6-methylphenyl) cyanate?
The IUPAC name of (2-chloro-3,5-dimethoxy-6-methylphenyl) cyanate (CID 145348564) is (2-chloro-3,5-dimethoxy-6-methylphenyl) cyanate.
What is the SMILES notation for (2-chloro-3,5-dimethoxy-6-methylphenyl) cyanate?
The canonical SMILES for (2-chloro-3,5-dimethoxy-6-methylphenyl) cyanate is COc1cc(OC)c(Cl)c(OC#N)c1C.
What is the InChIKey of (2-chloro-3,5-dimethoxy-6-methylphenyl) cyanate?
The InChIKey is CRNHRKMQSSFINM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClNO3/c1-6-7(13-2)4-8(14-3)9(11)10(6)15-5-12/h4H,1-3H3.
What are the key properties of (2-chloro-3,5-dimethoxy-6-methylphenyl) cyanate?
(2-chloro-3,5-dimethoxy-6-methylphenyl) cyanate has a molecular weight of 227.65 g/mol, XLogP of 2.53, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-3,5-dimethoxy-6-methylphenyl) cyanate is sourced from PubChem (CID 145348564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).