C13H16O4 — CID 175149276
1,2,5-trimethoxy-4-methyl-3-prop-1-ynoxybenzene (PubChem CID 175149276) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1,2,5-trimethoxy-4-methyl-3-prop-1-ynoxybenzene.
| Compound Name | 1,2,5-trimethoxy-4-methyl-3-prop-1-ynoxybenzene |
|---|---|
| PubChem CID | 175149276 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 1,2,5-trimethoxy-4-methyl-3-prop-1-ynoxybenzene |
| SMILES | CC#COc1c(C)c(OC)cc(OC)c1OC |
| InChI | InChI=1S/C13H16O4/c1-6-7-17-12-9(2)10(14-3)8-11(15-4)13(12)16-5/h8H,1-5H3 |
| InChIKey | CGEHATPPBAUEEP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|