C17H22N5+ — CID 11517435
2-(3-butylimidazol-3-ium-1-yl)-6-(3,5-dimethylpyrazol-1-yl)pyridine (PubChem CID 11517435) has the molecular formula C17H22N5+ and a molecular weight of 296.40 g/mol. Its IUPAC name is 2-(3-butylimidazol-3-ium-1-yl)-6-(3,5-dimethylpyrazol-1-yl)pyridine.
| Compound Name | 2-(3-butylimidazol-3-ium-1-yl)-6-(3,5-dimethylpyrazol-1-yl)pyridine |
|---|---|
| PubChem CID | 11517435 |
| Molecular Formula | C17H22N5+ |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 2-(3-butylimidazol-3-ium-1-yl)-6-(3,5-dimethylpyrazol-1-yl)pyridine |
| SMILES | CCCC[n+]1ccn(-c2cccc(-n3nc(C)cc3C)n2)c1 |
| InChI | InChI=1S/C17H22N5/c1-4-5-9-20-10-11-21(13-20)16-7-6-8-17(18-16)22-15(3)12-14(2)19-22/h6-8,10-13H,4-5,9H2,1-3H3/q+1 |
| InChIKey | OTYRRVBAAYXWDV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|