C12H20N2O2 — CID 115179044
2-hydroxy-2-methyl-N-[2-methyl-2-(1H-pyrrol-3-yl)propyl]propanamide (PubChem CID 115179044) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-N-[2-methyl-2-(1H-pyrrol-3-yl)propyl]propanamide.
| Compound Name | 2-hydroxy-2-methyl-N-[2-methyl-2-(1H-pyrrol-3-yl)propyl]propanamide |
|---|---|
| PubChem CID | 115179044 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2-hydroxy-2-methyl-N-[2-methyl-2-(1H-pyrrol-3-yl)propyl]propanamide |
| SMILES | CC(C)(O)C(=O)NCC(C)(C)c1cc[nH]c1 |
| InChI | InChI=1S/C12H20N2O2/c1-11(2,9-5-6-13-7-9)8-14-10(15)12(3,4)16/h5-7,13,16H,8H2,1-4H3,(H,14,15) |
| InChIKey | RYQCOEKPICUOAA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |