C14H24N2O2 — CID 115221241
2,2-dimethyl-4-[[2-methyl-2-(1H-pyrrol-3-yl)propyl]amino]butanoic acid (PubChem CID 115221241) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 2,2-dimethyl-4-[[2-methyl-2-(1H-pyrrol-3-yl)propyl]amino]butanoic acid.
| Compound Name | 2,2-dimethyl-4-[[2-methyl-2-(1H-pyrrol-3-yl)propyl]amino]butanoic acid |
|---|---|
| PubChem CID | 115221241 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 2,2-dimethyl-4-[[2-methyl-2-(1H-pyrrol-3-yl)propyl]amino]butanoic acid |
| SMILES | CC(C)(CCNCC(C)(C)c1cc[nH]c1)C(=O)O |
| InChI | InChI=1S/C14H24N2O2/c1-13(2,12(17)18)6-8-16-10-14(3,4)11-5-7-15-9-11/h5,7,9,15-16H,6,8,10H2,1-4H3,(H,17,18) |
| InChIKey | KOYOVPUUWGWNQU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|