C13H22N2O2 — CID 115233545
methyl 4-[[2-methyl-2-(1H-pyrrol-3-yl)propyl]amino]butanoate (PubChem CID 115233545) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is methyl 4-[[2-methyl-2-(1H-pyrrol-3-yl)propyl]amino]butanoate.
| Compound Name | methyl 4-[[2-methyl-2-(1H-pyrrol-3-yl)propyl]amino]butanoate |
|---|---|
| PubChem CID | 115233545 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | methyl 4-[[2-methyl-2-(1H-pyrrol-3-yl)propyl]amino]butanoate |
| SMILES | COC(=O)CCCNCC(C)(C)c1cc[nH]c1 |
| InChI | InChI=1S/C13H22N2O2/c1-13(2,11-6-8-14-9-11)10-15-7-4-5-12(16)17-3/h6,8-9,14-15H,4-5,7,10H2,1-3H3 |
| InChIKey | QOFGNPWFLFAFLT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|