C14H24N2O2 — CID 115187443
2-(hydroxymethyl)-3-methyl-N-[2-methyl-2-(1H-pyrrol-3-yl)propyl]butanamide (PubChem CID 115187443) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-(hydroxymethyl)-3-methyl-N-[2-methyl-2-(1H-pyrrol-3-yl)propyl]butanamide.
| Compound Name | 2-(hydroxymethyl)-3-methyl-N-[2-methyl-2-(1H-pyrrol-3-yl)propyl]butanamide |
|---|---|
| PubChem CID | 115187443 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 2-(hydroxymethyl)-3-methyl-N-[2-methyl-2-(1H-pyrrol-3-yl)propyl]butanamide |
| SMILES | CC(C)C(CO)C(=O)NCC(C)(C)c1cc[nH]c1 |
| InChI | InChI=1S/C14H24N2O2/c1-10(2)12(8-17)13(18)16-9-14(3,4)11-5-6-15-7-11/h5-7,10,12,15,17H,8-9H2,1-4H3,(H,16,18) |
| InChIKey | BIOSGIVEOASJMB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |