About ethyl 6-fluorohexanoate
ethyl 6-fluorohexanoate (PubChem CID 11518) has the molecular formula C8H15FO2
and a molecular weight of 162.20 g/mol. Its IUPAC name is ethyl 6-fluorohexanoate.
Molecular Properties
| Compound Name | ethyl 6-fluorohexanoate |
| PubChem CID | 11518 |
| Molecular Formula | C8H15FO2 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.11 |
| IUPAC Name | ethyl 6-fluorohexanoate |
| SMILES | CCOC(=O)CCCCCF |
| InChI | InChI=1S/C8H15FO2/c1-2-11-8(10)6-4-3-5-7-9/h2-7H2,1H3 |
| InChIKey | ARWCSVYFRYFFPQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-fluorohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-fluorohexanoate?
The IUPAC name of ethyl 6-fluorohexanoate (CID 11518) is ethyl 6-fluorohexanoate.
What is the SMILES notation for ethyl 6-fluorohexanoate?
The canonical SMILES for ethyl 6-fluorohexanoate is CCOC(=O)CCCCCF.
What is the InChIKey of ethyl 6-fluorohexanoate?
The InChIKey is ARWCSVYFRYFFPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15FO2/c1-2-11-8(10)6-4-3-5-7-9/h2-7H2,1H3.
What are the key properties of ethyl 6-fluorohexanoate?
ethyl 6-fluorohexanoate has a molecular weight of 162.20 g/mol, XLogP of 2.08, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-fluorohexanoate is sourced from PubChem (CID 11518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).