About ethyl 18-fluorooctadecanoate
ethyl 18-fluorooctadecanoate (PubChem CID 155894246) has the molecular formula C20H39FO2
and a molecular weight of 330.53 g/mol. Its IUPAC name is ethyl 18-fluorooctadecanoate.
Molecular Properties
| Compound Name | ethyl 18-fluorooctadecanoate |
| PubChem CID | 155894246 |
| Molecular Formula | C20H39FO2 |
| Molecular Weight | 330.53 g/mol |
| Exact Mass | 330.29 |
| IUPAC Name | ethyl 18-fluorooctadecanoate |
| SMILES | CCOC(=O)CCCCCCCCCCCCCCCCCF |
| InChI | InChI=1S/C20H39FO2/c1-2-23-20(22)18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-21/h2-19H2,1H3 |
| InChIKey | XHCJVIUSUCFRDH-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.53 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 18-fluorooctadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 18-fluorooctadecanoate?
The IUPAC name of ethyl 18-fluorooctadecanoate (CID 155894246) is ethyl 18-fluorooctadecanoate.
What is the SMILES notation for ethyl 18-fluorooctadecanoate?
The canonical SMILES for ethyl 18-fluorooctadecanoate is CCOC(=O)CCCCCCCCCCCCCCCCCF.
What is the InChIKey of ethyl 18-fluorooctadecanoate?
The InChIKey is XHCJVIUSUCFRDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H39FO2/c1-2-23-20(22)18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-21/h2-19H2,1H3.
What are the key properties of ethyl 18-fluorooctadecanoate?
ethyl 18-fluorooctadecanoate has a molecular weight of 330.53 g/mol, XLogP of 6.76, 18 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 18-fluorooctadecanoate is sourced from PubChem (CID 155894246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).