C7H9BrN2O2S — CID 115180285
3-amino-N-(4-bromothiophen-2-yl)-2-hydroxypropanamide (PubChem CID 115180285) has the molecular formula C7H9BrN2O2S and a molecular weight of 265.13 g/mol. Its IUPAC name is 3-amino-N-(4-bromothiophen-2-yl)-2-hydroxypropanamide.
| Compound Name | 3-amino-N-(4-bromothiophen-2-yl)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 115180285 |
| Molecular Formula | C7H9BrN2O2S |
| Molecular Weight | 265.13 g/mol |
| Exact Mass | 263.96 |
| IUPAC Name | 3-amino-N-(4-bromothiophen-2-yl)-2-hydroxypropanamide |
| SMILES | NCC(O)C(=O)Nc1cc(Br)cs1 |
| InChI | InChI=1S/C7H9BrN2O2S/c8-4-1-6(13-3-4)10-7(12)5(11)2-9/h1,3,5,11H,2,9H2,(H,10,12) |
| InChIKey | BEWOOALSUCUXST-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.13 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |