3-[(2,3,4-trimethylphenyl)carbamoyl]oxetane-3-carboxylic acid

C14H17NO4 — CID 115184921

IUPAC3-[(2,3,4-trimethylphenyl)carbamoyl]oxetane-3-carboxylic acid
SMILESCc1ccc(NC(=O)C2(C(=O)O)COC2)c(C)c1C
InChIInChI=1S/C14H17NO4/c1-8-4-5-11(10(3)9(8)2)15-12(16)14(13(17)18)6-19-7-14/h4-5H,6-7H2,1-3H3,(H,15,16)(H,17,18)
InChIKeyCFFLFGOHZVCYQZ-UHFFFAOYSA-N
MW263.29 g/mol
LogP1.65
Rot. Bonds3

About 3-[(2,3,4-trimethylphenyl)carbamoyl]oxetane-3-carboxylic acid

3-[(2,3,4-trimethylphenyl)carbamoyl]oxetane-3-carboxylic acid (PubChem CID 115184921) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 3-[(2,3,4-trimethylphenyl)carbamoyl]oxetane-3-carboxylic acid.

Molecular Properties

Compound Name3-[(2,3,4-trimethylphenyl)carbamoyl]oxetane-3-carboxylic acid
PubChem CID115184921
Molecular FormulaC14H17NO4
Molecular Weight263.29 g/mol
Exact Mass263.12
IUPAC Name3-[(2,3,4-trimethylphenyl)carbamoyl]oxetane-3-carboxylic acid
SMILESCc1ccc(NC(=O)C2(C(=O)O)COC2)c(C)c1C
InChIInChI=1S/C14H17NO4/c1-8-4-5-11(10(3)9(8)2)15-12(16)14(13(17)18)6-19-7-14/h4-5H,6-7H2,1-3H3,(H,15,16)(H,17,18)
InChIKeyCFFLFGOHZVCYQZ-UHFFFAOYSA-N
XLogP1.65
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.29
LogP ≤ 51.65
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 3-[(2,3,4-trimethylphenyl)carbamoyl]oxetane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2,3,4-trimethylphenyl)carbamoyl]oxetane-3-carboxylic acid?
The IUPAC name of 3-[(2,3,4-trimethylphenyl)carbamoyl]oxetane-3-carboxylic acid (CID 115184921) is 3-[(2,3,4-trimethylphenyl)carbamoyl]oxetane-3-carboxylic acid.
What is the SMILES notation for 3-[(2,3,4-trimethylphenyl)carbamoyl]oxetane-3-carboxylic acid?
The canonical SMILES for 3-[(2,3,4-trimethylphenyl)carbamoyl]oxetane-3-carboxylic acid is Cc1ccc(NC(=O)C2(C(=O)O)COC2)c(C)c1C.
What is the InChIKey of 3-[(2,3,4-trimethylphenyl)carbamoyl]oxetane-3-carboxylic acid?
The InChIKey is CFFLFGOHZVCYQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO4/c1-8-4-5-11(10(3)9(8)2)15-12(16)14(13(17)18)6-19-7-14/h4-5H,6-7H2,1-3H3,(H,15,16)(H,17,18).
What are the key properties of 3-[(2,3,4-trimethylphenyl)carbamoyl]oxetane-3-carboxylic acid?
3-[(2,3,4-trimethylphenyl)carbamoyl]oxetane-3-carboxylic acid has a molecular weight of 263.29 g/mol, XLogP of 1.65, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,3,4-trimethylphenyl)carbamoyl]oxetane-3-carboxylic acid is sourced from PubChem (CID 115184921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).