C38H48N2O4 — CID 175591909
oxalic acid;bis(2,3,4-trimethyl-N-(2,3,4-trimethylphenyl)aniline) (PubChem CID 175591909) has the molecular formula C38H48N2O4 and a molecular weight of 596.81 g/mol. Its IUPAC name is oxalic acid;bis(2,3,4-trimethyl-N-(2,3,4-trimethylphenyl)aniline).
| Compound Name | oxalic acid;bis(2,3,4-trimethyl-N-(2,3,4-trimethylphenyl)aniline) |
|---|---|
| PubChem CID | 175591909 |
| Molecular Formula | C38H48N2O4 |
| Molecular Weight | 596.81 g/mol |
| Exact Mass | 596.36 |
| IUPAC Name | oxalic acid;bis(2,3,4-trimethyl-N-(2,3,4-trimethylphenyl)aniline) |
| SMILES | Cc1ccc(Nc2ccc(C)c(C)c2C)c(C)c1C.Cc1ccc(Nc2ccc(C)c(C)c2C)c(C)c1C.O=C(O)C(=O)O |
| InChI | InChI=1S/2C18H23N.C2H2O4/c2*1-11-7-9-17(15(5)13(11)3)19-18-10-8-12(2)14(4)16(18)6;3-1(4)2(5)6/h2*7-10,19H,1-6H3;(H,3,4)(H,5,6) |
| InChIKey | FOFGPJCTPKPSTM-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.81 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|