C9H18N2O2 — CID 115192175
N'-(3,3-dimethylbutyl)-N'-methyloxamide (PubChem CID 115192175) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is N'-(3,3-dimethylbutyl)-N'-methyloxamide.
| Compound Name | N'-(3,3-dimethylbutyl)-N'-methyloxamide |
|---|---|
| PubChem CID | 115192175 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | N'-(3,3-dimethylbutyl)-N'-methyloxamide |
| SMILES | CN(CCC(C)(C)C)C(=O)C(N)=O |
| InChI | InChI=1S/C9H18N2O2/c1-9(2,3)5-6-11(4)8(13)7(10)12/h5-6H2,1-4H3,(H2,10,12) |
| InChIKey | PJWPGUMWHCLUFM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|