C13H29NO — CID 176686856
N-(3,3-dimethylbutyl)-N-methylbutanamide;ethane (PubChem CID 176686856) has the molecular formula C13H29NO and a molecular weight of 215.38 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-N-methylbutanamide;ethane.
| Compound Name | N-(3,3-dimethylbutyl)-N-methylbutanamide;ethane |
|---|---|
| PubChem CID | 176686856 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | N-(3,3-dimethylbutyl)-N-methylbutanamide;ethane |
| SMILES | CC.CCCC(=O)N(C)CCC(C)(C)C |
| InChI | InChI=1S/C11H23NO.C2H6/c1-6-7-10(13)12(5)9-8-11(2,3)4;1-2/h6-9H2,1-5H3;1-2H3 |
| InChIKey | KXYZQGQUGDDSSA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |