C43H87NO — CID 166648788
N-(3,3-dimethylbutyl)-9-ethyl-N,9,12,12,16,16,19,19,24,24-decamethylpentacosanamide (PubChem CID 166648788) has the molecular formula C43H87NO and a molecular weight of 634.18 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-9-ethyl-N,9,12,12,16,16,19,19,24,24-decamethylpentacosanamide.
| Compound Name | N-(3,3-dimethylbutyl)-9-ethyl-N,9,12,12,16,16,19,19,24,24-decamethylpentacosanamide |
|---|---|
| PubChem CID | 166648788 |
| Molecular Formula | C43H87NO |
| Molecular Weight | 634.18 g/mol |
| Exact Mass | 633.68 |
| IUPAC Name | N-(3,3-dimethylbutyl)-9-ethyl-N,9,12,12,16,16,19,19,24,24-decamethylpentacosanamide |
| SMILES | CCC(C)(CCCCCCCC(=O)N(C)CCC(C)(C)C)CCC(C)(C)CCCC(C)(C)CCC(C)(C)CCCCC(C)(C)C |
| InChI | InChI=1S/C43H87NO/c1-16-43(14,30-21-19-17-18-20-25-37(45)44(15)36-35-39(5,6)7)34-33-42(12,13)29-24-28-41(10,11)32-31-40(8,9)27-23-22-26-38(2,3)4/h16-36H2,1-15H3 |
| InChIKey | ASCOHOBTOWLRFV-UHFFFAOYSA-N |
| XLogP | 14.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.18 |
| LogP ≤ 5 | 14.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|