C15H31NO2 — CID 18991193
N-ethyl-N-hydroxy-10,10-dimethylundecanamide (PubChem CID 18991193) has the molecular formula C15H31NO2 and a molecular weight of 257.42 g/mol. Its IUPAC name is N-ethyl-N-hydroxy-10,10-dimethylundecanamide.
| Compound Name | N-ethyl-N-hydroxy-10,10-dimethylundecanamide |
|---|---|
| PubChem CID | 18991193 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | N-ethyl-N-hydroxy-10,10-dimethylundecanamide |
| SMILES | CCN(O)C(=O)CCCCCCCCC(C)(C)C |
| InChI | InChI=1S/C15H31NO2/c1-5-16(18)14(17)12-10-8-6-7-9-11-13-15(2,3)4/h18H,5-13H2,1-4H3 |
| InChIKey | ANJODXSOWQOXDJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|