C18H37NO — CID 153306649
N-(2,2-dimethylpropyl)-N-ethyl-8,8-dimethylnonanamide (PubChem CID 153306649) has the molecular formula C18H37NO and a molecular weight of 283.50 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-N-ethyl-8,8-dimethylnonanamide.
| Compound Name | N-(2,2-dimethylpropyl)-N-ethyl-8,8-dimethylnonanamide |
|---|---|
| PubChem CID | 153306649 |
| Molecular Formula | C18H37NO |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.29 |
| IUPAC Name | N-(2,2-dimethylpropyl)-N-ethyl-8,8-dimethylnonanamide |
| SMILES | CCN(CC(C)(C)C)C(=O)CCCCCCC(C)(C)C |
| InChI | InChI=1S/C18H37NO/c1-8-19(15-18(5,6)7)16(20)13-11-9-10-12-14-17(2,3)4/h8-15H2,1-7H3 |
| InChIKey | YVFMMBVHSRMDMO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|