C11H14BrNO3 — CID 115193445
N-(4,5-dimethoxy-2-methylphenyl)-N-methylcarbamoyl bromide (PubChem CID 115193445) has the molecular formula C11H14BrNO3 and a molecular weight of 288.14 g/mol. Its IUPAC name is N-(4,5-dimethoxy-2-methylphenyl)-N-methylcarbamoyl bromide.
| Compound Name | N-(4,5-dimethoxy-2-methylphenyl)-N-methylcarbamoyl bromide |
|---|---|
| PubChem CID | 115193445 |
| Molecular Formula | C11H14BrNO3 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | N-(4,5-dimethoxy-2-methylphenyl)-N-methylcarbamoyl bromide |
| SMILES | COc1cc(C)c(N(C)C(=O)Br)cc1OC |
| InChI | InChI=1S/C11H14BrNO3/c1-7-5-9(15-3)10(16-4)6-8(7)13(2)11(12)14/h5-6H,1-4H3 |
| InChIKey | PYDGPVAJKVCNGI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|