C31H54O7Si — CID 11519768
[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5S)-5-[(1E)-3-[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]buta-1,3-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropyl] 2,2-dimethylpropanoate (PubChem CID 11519768) has the molecular formula C31H54O7Si and a molecular weight of 566.85 g/mol. Its IUPAC name is [(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5S)-5-[(1E)-3-[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]buta-1,3-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5S)-5-[(1E)-3-[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]buta-1,3-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11519768 |
| Molecular Formula | C31H54O7Si |
| Molecular Weight | 566.85 g/mol |
| Exact Mass | 566.36 |
| IUPAC Name | [(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5S)-5-[(1E)-3-[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]buta-1,3-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropyl] 2,2-dimethylpropanoate |
| SMILES | C=C(/C=C/[C@@H]1OC(C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)COC(=O)C(C)(C)C)[C@H]1COC2(CCCC2)O1 |
| InChI | InChI=1S/C31H54O7Si/c1-21(24-20-34-31(36-24)17-13-14-18-31)15-16-23-26(37-30(9,10)35-23)25(38-39(11,12)29(6,7)8)22(2)19-33-27(32)28(3,4)5/h15-16,22-26H,1,13-14,17-20H2,2-12H3/b16-15+/t22-,23+,24-,25-,26+/m1/s1 |
| InChIKey | VISCQIHEVICVBY-DGWOCFCFSA-N |
| XLogP | 6.92 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.85 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|