C24H44O7Si — CID 177429100
methyl (Z)-6-[(4S,5R)-5-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-enoate (PubChem CID 177429100) has the molecular formula C24H44O7Si and a molecular weight of 472.70 g/mol. Its IUPAC name is methyl (Z)-6-[(4S,5R)-5-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-enoate.
| Compound Name | methyl (Z)-6-[(4S,5R)-5-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-enoate |
|---|---|
| PubChem CID | 177429100 |
| Molecular Formula | C24H44O7Si |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | methyl (Z)-6-[(4S,5R)-5-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-enoate |
| SMILES | COC(=O)CCC/C=C\[C@@H]1OC(C)(C)O[C@H]1[C@H]1OC(C)(C)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H44O7Si/c1-22(2,3)32(9,10)27-16-18-21(31-24(6,7)29-18)20-17(28-23(4,5)30-20)14-12-11-13-15-19(25)26-8/h12,14,17-18,20-21H,11,13,15-16H2,1-10H3/b14-12-/t17-,18+,20+,21-/m0/s1 |
| InChIKey | XBFXSLLPNJTVKJ-BFFSCPHISA-N |
| XLogP | 4.95 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|