C28H48O7Si — CID 178184630
ethyl (E)-3-[(2S,3S)-3-[(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-triethylsilyloxymethyl]-1,4-dioxaspiro[4.5]decan-2-yl]prop-2-enoate (PubChem CID 178184630) has the molecular formula C28H48O7Si and a molecular weight of 524.77 g/mol. Its IUPAC name is ethyl (E)-3-[(2S,3S)-3-[(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-triethylsilyloxymethyl]-1,4-dioxaspiro[4.5]decan-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2S,3S)-3-[(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-triethylsilyloxymethyl]-1,4-dioxaspiro[4.5]decan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 178184630 |
| Molecular Formula | C28H48O7Si |
| Molecular Weight | 524.77 g/mol |
| Exact Mass | 524.32 |
| IUPAC Name | ethyl (E)-3-[(2S,3S)-3-[(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-triethylsilyloxymethyl]-1,4-dioxaspiro[4.5]decan-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H]1OC2(CCCCC2)O[C@@H]1[C@@H](O[Si](CC)(CC)CC)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C28H48O7Si/c1-5-30-24(29)16-15-22-25(34-28(32-22)19-13-10-14-20-28)26(35-36(6-2,7-3)8-4)23-21-31-27(33-23)17-11-9-12-18-27/h15-16,22-23,25-26H,5-14,17-21H2,1-4H3/b16-15+/t22-,23+,25-,26-/m0/s1 |
| InChIKey | PQBLSTFKAGYMMV-JSBAKAAPSA-N |
| XLogP | 6.02 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.77 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|