C25H48O11Si — CID 10816533
ethyl (E,4S,5S)-4,5-bis(methoxymethoxy)-5-[(2S,3R,4S,5R)-4-(methoxymethoxy)-5-(methoxymethyl)-3-triethylsilyloxyoxolan-2-yl]pent-2-enoate (PubChem CID 10816533) has the molecular formula C25H48O11Si and a molecular weight of 552.73 g/mol. Its IUPAC name is ethyl (E,4S,5S)-4,5-bis(methoxymethoxy)-5-[(2S,3R,4S,5R)-4-(methoxymethoxy)-5-(methoxymethyl)-3-triethylsilyloxyoxolan-2-yl]pent-2-enoate.
| Compound Name | ethyl (E,4S,5S)-4,5-bis(methoxymethoxy)-5-[(2S,3R,4S,5R)-4-(methoxymethoxy)-5-(methoxymethyl)-3-triethylsilyloxyoxolan-2-yl]pent-2-enoate |
|---|---|
| PubChem CID | 10816533 |
| Molecular Formula | C25H48O11Si |
| Molecular Weight | 552.73 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | ethyl (E,4S,5S)-4,5-bis(methoxymethoxy)-5-[(2S,3R,4S,5R)-4-(methoxymethoxy)-5-(methoxymethyl)-3-triethylsilyloxyoxolan-2-yl]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](OCOC)[C@H](OCOC)[C@@H]1O[C@H](COC)[C@H](OCOC)[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C25H48O11Si/c1-9-31-21(26)14-13-19(32-16-28-6)22(33-17-29-7)24-25(36-37(10-2,11-3)12-4)23(34-18-30-8)20(35-24)15-27-5/h13-14,19-20,22-25H,9-12,15-18H2,1-8H3/b14-13+/t19-,20+,22-,23-,24-,25-/m0/s1 |
| InChIKey | ASKUXEZVAKGKBK-JNWVKHBASA-N |
| XLogP | 2.88 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.73 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|