C21H36O7Si — CID 11004479
(2S)-2-[(R)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-triethylsilyloxymethyl]-3-(methoxymethoxy)-2H-furan-5-one (PubChem CID 11004479) has the molecular formula C21H36O7Si and a molecular weight of 428.60 g/mol. Its IUPAC name is (2S)-2-[(R)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-triethylsilyloxymethyl]-3-(methoxymethoxy)-2H-furan-5-one.
| Compound Name | (2S)-2-[(R)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-triethylsilyloxymethyl]-3-(methoxymethoxy)-2H-furan-5-one |
|---|---|
| PubChem CID | 11004479 |
| Molecular Formula | C21H36O7Si |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | (2S)-2-[(R)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-triethylsilyloxymethyl]-3-(methoxymethoxy)-2H-furan-5-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]([C@@H]1OC(=O)C=C1OCOC)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C21H36O7Si/c1-5-29(6-2,7-3)28-20(19-16(24-15-23-4)13-18(22)26-19)17-14-25-21(27-17)11-9-8-10-12-21/h13,17,19-20H,5-12,14-15H2,1-4H3/t17-,19-,20-/m1/s1 |
| InChIKey | DBXLXAXCPJOVFJ-MISYRCLQSA-N |
| XLogP | 3.88 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|