C23H42O7Si — CID 10950578
methyl (E)-3-[(4S,5S)-5-[(1R,2R)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 10950578) has the molecular formula C23H42O7Si and a molecular weight of 458.67 g/mol. Its IUPAC name is methyl (E)-3-[(4S,5S)-5-[(1R,2R)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(4S,5S)-5-[(1R,2R)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10950578 |
| Molecular Formula | C23H42O7Si |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | methyl (E)-3-[(4S,5S)-5-[(1R,2R)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H]1OC(C)(C)O[C@H]1[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C23H42O7Si/c1-15(19-16(12-13-18(24)25-9)27-23(7,8)29-19)20(17-14-26-22(5,6)28-17)30-31(10,11)21(2,3)4/h12-13,15-17,19-20H,14H2,1-11H3/b13-12+/t15-,16+,17-,19+,20-/m1/s1 |
| InChIKey | ISVSSCFEIYYZGI-JEKRBBQNSA-N |
| XLogP | 4.41 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|