C30H50O8Si — CID 164674989
ethyl (E)-3-[(2R,3S)-3-[(2S,3S)-3-[(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-triethylsilyloxymethyl]-1,4-dioxaspiro[4.5]decan-2-yl]oxiran-2-yl]prop-2-enoate (PubChem CID 164674989) has the molecular formula C30H50O8Si and a molecular weight of 566.81 g/mol. Its IUPAC name is ethyl (E)-3-[(2R,3S)-3-[(2S,3S)-3-[(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-triethylsilyloxymethyl]-1,4-dioxaspiro[4.5]decan-2-yl]oxiran-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2R,3S)-3-[(2S,3S)-3-[(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-triethylsilyloxymethyl]-1,4-dioxaspiro[4.5]decan-2-yl]oxiran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 164674989 |
| Molecular Formula | C30H50O8Si |
| Molecular Weight | 566.81 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | ethyl (E)-3-[(2R,3S)-3-[(2S,3S)-3-[(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-triethylsilyloxymethyl]-1,4-dioxaspiro[4.5]decan-2-yl]oxiran-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1O[C@@H]1[C@@H]1OC2(CCCCC2)O[C@@H]1[C@@H](O[Si](CC)(CC)CC)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C30H50O8Si/c1-5-32-24(31)16-15-22-25(34-22)27-28(37-30(36-27)19-13-10-14-20-30)26(38-39(6-2,7-3)8-4)23-21-33-29(35-23)17-11-9-12-18-29/h15-16,22-23,25-28H,5-14,17-21H2,1-4H3/b16-15+/t22-,23-,25+,26+,27+,28-/m1/s1 |
| InChIKey | DSBFSINCMMPZSX-PKDQHPMKSA-N |
| XLogP | 5.78 |
| TPSA | 84.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.81 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|