C19H34O6Si — CID 71723106
ethyl (E)-3-[(2R,3S)-3-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]oxiran-2-yl]prop-2-enoate (PubChem CID 71723106) has the molecular formula C19H34O6Si and a molecular weight of 386.56 g/mol. Its IUPAC name is ethyl (E)-3-[(2R,3S)-3-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]oxiran-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2R,3S)-3-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]oxiran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 71723106 |
| Molecular Formula | C19H34O6Si |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | ethyl (E)-3-[(2R,3S)-3-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]oxiran-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1O[C@@H]1[C@H]1OC(C)(C)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34O6Si/c1-9-21-15(20)11-10-13-16(23-13)17-14(24-19(5,6)25-17)12-22-26(7,8)18(2,3)4/h10-11,13-14,16-17H,9,12H2,1-8H3/b11-10+/t13-,14-,16+,17+/m1/s1 |
| InChIKey | VRJGJVOSPUKDHA-PLEGVCHLSA-N |
| XLogP | 3.41 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|