C24H42O8Si — CID 11081429
ethyl (E)-3-[(4S,5S)-5-[(4aR,6S,7R,7aS)-2,2-dimethyl-7-triethylsilyloxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-6-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 11081429) has the molecular formula C24H42O8Si and a molecular weight of 486.68 g/mol. Its IUPAC name is ethyl (E)-3-[(4S,5S)-5-[(4aR,6S,7R,7aS)-2,2-dimethyl-7-triethylsilyloxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-6-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(4S,5S)-5-[(4aR,6S,7R,7aS)-2,2-dimethyl-7-triethylsilyloxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-6-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11081429 |
| Molecular Formula | C24H42O8Si |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | ethyl (E)-3-[(4S,5S)-5-[(4aR,6S,7R,7aS)-2,2-dimethyl-7-triethylsilyloxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-6-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H]1OC(C)(C)O[C@@H]1[C@@H]1O[C@@H]2COC(C)(C)O[C@@H]2[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H42O8Si/c1-9-26-18(25)14-13-16-19(31-24(7,8)29-16)21-22(32-33(10-2,11-3)12-4)20-17(28-21)15-27-23(5,6)30-20/h13-14,16-17,19-22H,9-12,15H2,1-8H3/b14-13+/t16-,17+,19-,20-,21-,22-/m0/s1 |
| InChIKey | SYDNCPUYUDQAJJ-LYYHNYBMSA-N |
| XLogP | 3.94 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|