C27H46O6Si — CID 178184628
[(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-[(2S,3S)-2-[(2S,3R)-3-ethenyloxiran-2-yl]-1,4-dioxaspiro[4.5]decan-3-yl]methoxy]-triethylsilane (PubChem CID 178184628) has the molecular formula C27H46O6Si and a molecular weight of 494.75 g/mol. Its IUPAC name is [(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-[(2S,3S)-2-[(2S,3R)-3-ethenyloxiran-2-yl]-1,4-dioxaspiro[4.5]decan-3-yl]methoxy]-triethylsilane.
| Compound Name | [(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-[(2S,3S)-2-[(2S,3R)-3-ethenyloxiran-2-yl]-1,4-dioxaspiro[4.5]decan-3-yl]methoxy]-triethylsilane |
|---|---|
| PubChem CID | 178184628 |
| Molecular Formula | C27H46O6Si |
| Molecular Weight | 494.75 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | [(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-[(2S,3S)-2-[(2S,3R)-3-ethenyloxiran-2-yl]-1,4-dioxaspiro[4.5]decan-3-yl]methoxy]-triethylsilane |
| SMILES | C=C[C@H]1O[C@@H]1[C@@H]1OC2(CCCCC2)O[C@@H]1[C@@H](O[Si](CC)(CC)CC)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C27H46O6Si/c1-5-20-22(29-20)24-25(32-27(31-24)17-13-10-14-18-27)23(33-34(6-2,7-3)8-4)21-19-28-26(30-21)15-11-9-12-16-26/h5,20-25H,1,6-19H2,2-4H3/t20-,21-,22+,23+,24+,25-/m1/s1 |
| InChIKey | GACVESNZIHAZJS-RWNMKMRESA-N |
| XLogP | 5.85 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.75 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|