C27H52O4Si — CID 11730362
tert-butyl-[2-[(4S,5S)-5-[2-[(2R,3R)-3-[(E)-dec-1-enyl]oxiran-2-yl]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-dimethylsilane (PubChem CID 11730362) has the molecular formula C27H52O4Si and a molecular weight of 468.80 g/mol. Its IUPAC name is tert-butyl-[2-[(4S,5S)-5-[2-[(2R,3R)-3-[(E)-dec-1-enyl]oxiran-2-yl]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(4S,5S)-5-[2-[(2R,3R)-3-[(E)-dec-1-enyl]oxiran-2-yl]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11730362 |
| Molecular Formula | C27H52O4Si |
| Molecular Weight | 468.80 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | tert-butyl-[2-[(4S,5S)-5-[2-[(2R,3R)-3-[(E)-dec-1-enyl]oxiran-2-yl]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-dimethylsilane |
| SMILES | CCCCCCCC/C=C/[C@H]1O[C@@H]1CC[C@@H]1OC(C)(C)O[C@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H52O4Si/c1-9-10-11-12-13-14-15-16-17-22-23(29-22)18-19-24-25(31-27(5,6)30-24)20-21-28-32(7,8)26(2,3)4/h16-17,22-25H,9-15,18-21H2,1-8H3/b17-16+/t22-,23-,24+,25+/m1/s1 |
| InChIKey | WAIJSVKGBYTCSZ-JSGRDAPOSA-N |
| XLogP | 7.77 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.80 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|