C32H60O6Si — CID 10793136
tert-butyl-[[(2S,3S)-3-[(4R,5S)-5-[(Z)-8-(2-hexyl-1,3-dioxolan-2-yl)oct-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyloxiran-2-yl]methoxy]-dimethylsilane (PubChem CID 10793136) has the molecular formula C32H60O6Si and a molecular weight of 568.91 g/mol. Its IUPAC name is tert-butyl-[[(2S,3S)-3-[(4R,5S)-5-[(Z)-8-(2-hexyl-1,3-dioxolan-2-yl)oct-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyloxiran-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S,3S)-3-[(4R,5S)-5-[(Z)-8-(2-hexyl-1,3-dioxolan-2-yl)oct-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyloxiran-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10793136 |
| Molecular Formula | C32H60O6Si |
| Molecular Weight | 568.91 g/mol |
| Exact Mass | 568.42 |
| IUPAC Name | tert-butyl-[[(2S,3S)-3-[(4R,5S)-5-[(Z)-8-(2-hexyl-1,3-dioxolan-2-yl)oct-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyloxiran-2-yl]methoxy]-dimethylsilane |
| SMILES | CCCCCCC1(CCCCCC/C=C\[C@@H]2OC(C)(C)O[C@H]2[C@@H]2O[C@@]2(C)CO[Si](C)(C)C(C)(C)C)OCCO1 |
| InChI | InChI=1S/C32H60O6Si/c1-10-11-12-18-21-32(33-23-24-34-32)22-19-16-14-13-15-17-20-26-27(37-30(5,6)36-26)28-31(7,38-28)25-35-39(8,9)29(2,3)4/h17,20,26-28H,10-16,18-19,21-25H2,1-9H3/b20-17-/t26-,27+,28-,31-/m0/s1 |
| InChIKey | OQNFKBIQGOGVJI-AXQYUXLXSA-N |
| XLogP | 8.30 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.91 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|