C31H44N4O6 — CID 11519786
(3S,18S)-N-(1-amino-1,2-dioxohexan-3-yl)-3-cyclohexyl-2,5-dioxo-12-oxa-1,4-diazatricyclo[11.5.3.016,20]henicosa-13(21),14,16(20)-triene-18-carboxamide (PubChem CID 11519786) has the molecular formula C31H44N4O6 and a molecular weight of 568.72 g/mol. Its IUPAC name is (3S,18S)-N-(1-amino-1,2-dioxohexan-3-yl)-3-cyclohexyl-2,5-dioxo-12-oxa-1,4-diazatricyclo[11.5.3.016,20]henicosa-13(21),14,16(20)-triene-18-carboxamide.
| Compound Name | (3S,18S)-N-(1-amino-1,2-dioxohexan-3-yl)-3-cyclohexyl-2,5-dioxo-12-oxa-1,4-diazatricyclo[11.5.3.016,20]henicosa-13(21),14,16(20)-triene-18-carboxamide |
|---|---|
| PubChem CID | 11519786 |
| Molecular Formula | C31H44N4O6 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.33 |
| IUPAC Name | (3S,18S)-N-(1-amino-1,2-dioxohexan-3-yl)-3-cyclohexyl-2,5-dioxo-12-oxa-1,4-diazatricyclo[11.5.3.016,20]henicosa-13(21),14,16(20)-triene-18-carboxamide |
| SMILES | CCCC(NC(=O)[C@@H]1Cc2ccc3cc2CN1C(=O)[C@H](C1CCCCC1)NC(=O)CCCCCCO3)C(=O)C(N)=O |
| InChI | InChI=1S/C31H44N4O6/c1-2-10-24(28(37)29(32)38)33-30(39)25-18-21-14-15-23-17-22(21)19-35(25)31(40)27(20-11-6-5-7-12-20)34-26(36)13-8-3-4-9-16-41-23/h14-15,17,20,24-25,27H,2-13,16,18-19H2,1H3,(H2,32,38)(H,33,39)(H,34,36)/t24?,25-,27-/m0/s1 |
| InChIKey | HFNOJRNMQBCLBR-XICMLOBYSA-N |
| XLogP | 2.69 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|