C16H25N3 — CID 115200722
1-N,3-dimethyl-1-N-[(2-methyl-1H-indol-3-yl)methyl]butane-1,3-diamine (PubChem CID 115200722) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 1-N,3-dimethyl-1-N-[(2-methyl-1H-indol-3-yl)methyl]butane-1,3-diamine.
| Compound Name | 1-N,3-dimethyl-1-N-[(2-methyl-1H-indol-3-yl)methyl]butane-1,3-diamine |
|---|---|
| PubChem CID | 115200722 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 1-N,3-dimethyl-1-N-[(2-methyl-1H-indol-3-yl)methyl]butane-1,3-diamine |
| SMILES | Cc1[nH]c2ccccc2c1CN(C)CCC(C)(C)N |
| InChI | InChI=1S/C16H25N3/c1-12-14(11-19(4)10-9-16(2,3)17)13-7-5-6-8-15(13)18-12/h5-8,18H,9-11,17H2,1-4H3 |
| InChIKey | CJFSYXMDLXUQJX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|