C14H21N3 — CID 115200369
3-methyl-1-N-(2-methyl-1H-indol-3-yl)butane-1,3-diamine (PubChem CID 115200369) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 3-methyl-1-N-(2-methyl-1H-indol-3-yl)butane-1,3-diamine.
| Compound Name | 3-methyl-1-N-(2-methyl-1H-indol-3-yl)butane-1,3-diamine |
|---|---|
| PubChem CID | 115200369 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 3-methyl-1-N-(2-methyl-1H-indol-3-yl)butane-1,3-diamine |
| SMILES | Cc1[nH]c2ccccc2c1NCCC(C)(C)N |
| InChI | InChI=1S/C14H21N3/c1-10-13(16-9-8-14(2,3)15)11-6-4-5-7-12(11)17-10/h4-7,16-17H,8-9,15H2,1-3H3 |
| InChIKey | QSOPIBUSMMBXAH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |