C13H19N3 — CID 115199020
1-N-(2-methyl-1H-indol-3-yl)butane-1,3-diamine (PubChem CID 115199020) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 1-N-(2-methyl-1H-indol-3-yl)butane-1,3-diamine.
| Compound Name | 1-N-(2-methyl-1H-indol-3-yl)butane-1,3-diamine |
|---|---|
| PubChem CID | 115199020 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 1-N-(2-methyl-1H-indol-3-yl)butane-1,3-diamine |
| SMILES | Cc1[nH]c2ccccc2c1NCCC(C)N |
| InChI | InChI=1S/C13H19N3/c1-9(14)7-8-15-13-10(2)16-12-6-4-3-5-11(12)13/h3-6,9,15-16H,7-8,14H2,1-2H3 |
| InChIKey | KKLRGVVDHJJANI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |