C14H24N2S — CID 115202135
N-methyl-N'-[2-(4-methylsulfanylphenyl)ethyl]butane-1,4-diamine (PubChem CID 115202135) has the molecular formula C14H24N2S and a molecular weight of 252.43 g/mol. Its IUPAC name is N-methyl-N'-[2-(4-methylsulfanylphenyl)ethyl]butane-1,4-diamine.
| Compound Name | N-methyl-N'-[2-(4-methylsulfanylphenyl)ethyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 115202135 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | N-methyl-N'-[2-(4-methylsulfanylphenyl)ethyl]butane-1,4-diamine |
| SMILES | CNCCCCNCCc1ccc(SC)cc1 |
| InChI | InChI=1S/C14H24N2S/c1-15-10-3-4-11-16-12-9-13-5-7-14(17-2)8-6-13/h5-8,15-16H,3-4,9-12H2,1-2H3 |
| InChIKey | YKNBOKVVKVHZLJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|