C13H22N2S — CID 115206026
N-ethyl-N'-[2-(4-methylsulfanylphenyl)ethyl]ethane-1,2-diamine (PubChem CID 115206026) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is N-ethyl-N'-[2-(4-methylsulfanylphenyl)ethyl]ethane-1,2-diamine.
| Compound Name | N-ethyl-N'-[2-(4-methylsulfanylphenyl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 115206026 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N-ethyl-N'-[2-(4-methylsulfanylphenyl)ethyl]ethane-1,2-diamine |
| SMILES | CCNCCNCCc1ccc(SC)cc1 |
| InChI | InChI=1S/C13H22N2S/c1-3-14-10-11-15-9-8-12-4-6-13(16-2)7-5-12/h4-7,14-15H,3,8-11H2,1-2H3 |
| InChIKey | MEJRMLQSAOJJEI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|