C15H26N2S — CID 115205015
2,2-dimethyl-N'-[2-(4-methylsulfanylphenyl)ethyl]butane-1,4-diamine (PubChem CID 115205015) has the molecular formula C15H26N2S and a molecular weight of 266.45 g/mol. Its IUPAC name is 2,2-dimethyl-N'-[2-(4-methylsulfanylphenyl)ethyl]butane-1,4-diamine.
| Compound Name | 2,2-dimethyl-N'-[2-(4-methylsulfanylphenyl)ethyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 115205015 |
| Molecular Formula | C15H26N2S |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 2,2-dimethyl-N'-[2-(4-methylsulfanylphenyl)ethyl]butane-1,4-diamine |
| SMILES | CSc1ccc(CCNCCC(C)(C)CN)cc1 |
| InChI | InChI=1S/C15H26N2S/c1-15(2,12-16)9-11-17-10-8-13-4-6-14(18-3)7-5-13/h4-7,17H,8-12,16H2,1-3H3 |
| InChIKey | UHVLDTJRSBFYSH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|