C29H36N2Na2O10S3 — CID 11520488
disodium;4-[3-(3-carboxylatopropanoylsulfanyl)-8-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl-methylamino]-8-oxooctyl]sulfanyl-4-oxobutanoate (PubChem CID 11520488) has the molecular formula C29H36N2Na2O10S3 and a molecular weight of 714.79 g/mol. Its IUPAC name is disodium;4-[3-(3-carboxylatopropanoylsulfanyl)-8-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl-methylamino]-8-oxooctyl]sulfanyl-4-oxobutanoate.
| Compound Name | disodium;4-[3-(3-carboxylatopropanoylsulfanyl)-8-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl-methylamino]-8-oxooctyl]sulfanyl-4-oxobutanoate |
|---|---|
| PubChem CID | 11520488 |
| Molecular Formula | C29H36N2Na2O10S3 |
| Molecular Weight | 714.79 g/mol |
| Exact Mass | 714.13 |
| IUPAC Name | disodium;4-[3-(3-carboxylatopropanoylsulfanyl)-8-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl-methylamino]-8-oxooctyl]sulfanyl-4-oxobutanoate |
| SMILES | CN(CCOc1ccc(CC2SC(=O)NC2=O)cc1)C(=O)CCCCC(CCSC(=O)CCC(=O)[O-])SC(=O)CCC(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C29H38N2O10S3.2Na/c1-31(15-16-41-20-8-6-19(7-9-20)18-22-28(39)30-29(40)44-22)23(32)5-3-2-4-21(43-27(38)13-11-25(35)36)14-17-42-26(37)12-10-24(33)34;;/h6-9,21-22H,2-5,10-18H2,1H3,(H,33,34)(H,35,36)(H,30,39,40);;/q;2*+1/p-2 |
| InChIKey | JRVKBNKIKYFANW-UHFFFAOYSA-L |
| XLogP | -4.68 |
| TPSA | 190.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.79 |
| LogP ≤ 5 | -4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|