C13H20N2S — CID 115206764
N-cyclopropyl-N'-(4-ethylsulfanylphenyl)ethane-1,2-diamine (PubChem CID 115206764) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is N-cyclopropyl-N'-(4-ethylsulfanylphenyl)ethane-1,2-diamine.
| Compound Name | N-cyclopropyl-N'-(4-ethylsulfanylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 115206764 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | N-cyclopropyl-N'-(4-ethylsulfanylphenyl)ethane-1,2-diamine |
| SMILES | CCSc1ccc(NCCNC2CC2)cc1 |
| InChI | InChI=1S/C13H20N2S/c1-2-16-13-7-5-12(6-8-13)15-10-9-14-11-3-4-11/h5-8,11,14-15H,2-4,9-10H2,1H3 |
| InChIKey | WBGOWLNSFCIQKU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|