C12H25N3 — CID 115214151
3-[[(1-methylpiperidin-4-yl)methylamino]methyl]cyclobutan-1-amine (PubChem CID 115214151) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is 3-[[(1-methylpiperidin-4-yl)methylamino]methyl]cyclobutan-1-amine.
| Compound Name | 3-[[(1-methylpiperidin-4-yl)methylamino]methyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 115214151 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 3-[[(1-methylpiperidin-4-yl)methylamino]methyl]cyclobutan-1-amine |
| SMILES | CN1CCC(CNCC2CC(N)C2)CC1 |
| InChI | InChI=1S/C12H25N3/c1-15-4-2-10(3-5-15)8-14-9-11-6-12(13)7-11/h10-12,14H,2-9,13H2,1H3 |
| InChIKey | IAFGSOXZADZADE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |