About 3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]benzamide
3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]benzamide (PubChem CID 11521945) has the molecular formula C16H24N2O2
and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]benzamide.
Molecular Properties
| Compound Name | 3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]benzamide |
| PubChem CID | 11521945 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]benzamide |
| SMILES | CN(C)C[C@H]1CCCC[C@]1(O)c1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C16H24N2O2/c1-18(2)11-14-7-3-4-9-16(14,20)13-8-5-6-12(10-13)15(17)19/h5-6,8,10,14,20H,3-4,7,9,11H2,1-2H3,(H2,17,19)/t14-,16+/m1/s1 |
| InChIKey | HMYGNTXDYGVULQ-ZBFHGGJFSA-N |
| XLogP | 1.72 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]benzamide?
The IUPAC name of 3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]benzamide (CID 11521945) is 3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]benzamide.
What is the SMILES notation for 3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]benzamide?
The canonical SMILES for 3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]benzamide is CN(C)C[C@H]1CCCC[C@]1(O)c1cccc(C(N)=O)c1.
What is the InChIKey of 3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]benzamide?
The InChIKey is HMYGNTXDYGVULQ-ZBFHGGJFSA-N. The full InChI is InChI=1S/C16H24N2O2/c1-18(2)11-14-7-3-4-9-16(14,20)13-8-5-6-12(10-13)15(17)19/h5-6,8,10,14,20H,3-4,7,9,11H2,1-2H3,(H2,17,19)/t14-,16+/m1/s1.
What are the key properties of 3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]benzamide?
3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]benzamide has a molecular weight of 276.38 g/mol, XLogP of 1.72, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]benzamide is sourced from PubChem (CID 11521945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).