C29H42N2O2 — CID 46190938
3-[4-[4-(3-hydroxypentan-3-yl)phenyl]-1-(2-methylpentyl)piperidin-4-yl]benzamide (PubChem CID 46190938) has the molecular formula C29H42N2O2 and a molecular weight of 450.67 g/mol. Its IUPAC name is 3-[4-[4-(3-hydroxypentan-3-yl)phenyl]-1-(2-methylpentyl)piperidin-4-yl]benzamide.
| Compound Name | 3-[4-[4-(3-hydroxypentan-3-yl)phenyl]-1-(2-methylpentyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 46190938 |
| Molecular Formula | C29H42N2O2 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | 3-[4-[4-(3-hydroxypentan-3-yl)phenyl]-1-(2-methylpentyl)piperidin-4-yl]benzamide |
| SMILES | CCCC(C)CN1CCC(c2ccc(C(O)(CC)CC)cc2)(c2cccc(C(N)=O)c2)CC1 |
| InChI | InChI=1S/C29H42N2O2/c1-5-9-22(4)21-31-18-16-28(17-19-31,26-11-8-10-23(20-26)27(30)32)24-12-14-25(15-13-24)29(33,6-2)7-3/h8,10-15,20,22,33H,5-7,9,16-19,21H2,1-4H3,(H2,30,32) |
| InChIKey | MAPOTTLVIWZPHI-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |