C27H36N2O2 — CID 46226176
3-[1-(cyclopropylmethyl)-4-[4-(3-hydroxypentan-3-yl)phenyl]piperidin-4-yl]benzamide (PubChem CID 46226176) has the molecular formula C27H36N2O2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 3-[1-(cyclopropylmethyl)-4-[4-(3-hydroxypentan-3-yl)phenyl]piperidin-4-yl]benzamide.
| Compound Name | 3-[1-(cyclopropylmethyl)-4-[4-(3-hydroxypentan-3-yl)phenyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 46226176 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 3-[1-(cyclopropylmethyl)-4-[4-(3-hydroxypentan-3-yl)phenyl]piperidin-4-yl]benzamide |
| SMILES | CCC(O)(CC)c1ccc(C2(c3cccc(C(N)=O)c3)CCN(CC3CC3)CC2)cc1 |
| InChI | InChI=1S/C27H36N2O2/c1-3-27(31,4-2)23-12-10-22(11-13-23)26(24-7-5-6-21(18-24)25(28)30)14-16-29(17-15-26)19-20-8-9-20/h5-7,10-13,18,20,31H,3-4,8-9,14-17,19H2,1-2H3,(H2,28,30) |
| InChIKey | NSZMMTQRGQBJNB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |