C16H19NO — CID 11521964
1-(4-methylphenyl)-2-pyrrolidin-1-ylpent-4-yn-1-one (PubChem CID 11521964) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2-pyrrolidin-1-ylpent-4-yn-1-one.
| Compound Name | 1-(4-methylphenyl)-2-pyrrolidin-1-ylpent-4-yn-1-one |
|---|---|
| PubChem CID | 11521964 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 1-(4-methylphenyl)-2-pyrrolidin-1-ylpent-4-yn-1-one |
| SMILES | C#CCC(C(=O)c1ccc(C)cc1)N1CCCC1 |
| InChI | InChI=1S/C16H19NO/c1-3-6-15(17-11-4-5-12-17)16(18)14-9-7-13(2)8-10-14/h1,7-10,15H,4-6,11-12H2,2H3 |
| InChIKey | RRFLDGUEDAERPR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|