C15H22ClNO — CID 71750583
1-(4-methylphenyl)-2-(2,2,3,3,4,4,5,5-octadeuteriopyrrolidin-1-yl)butan-1-one;hydrochloride (PubChem CID 71750583) has the molecular formula C15H22ClNO and a molecular weight of 275.85 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2-(2,2,3,3,4,4,5,5-octadeuteriopyrrolidin-1-yl)butan-1-one;hydrochloride.
| Compound Name | 1-(4-methylphenyl)-2-(2,2,3,3,4,4,5,5-octadeuteriopyrrolidin-1-yl)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 71750583 |
| Molecular Formula | C15H22ClNO |
| Molecular Weight | 275.85 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 1-(4-methylphenyl)-2-(2,2,3,3,4,4,5,5-octadeuteriopyrrolidin-1-yl)butan-1-one;hydrochloride |
| SMILES | Cl.[2H]C1([2H])N(C(CC)C(=O)c2ccc(C)cc2)C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C15H21NO.ClH/c1-3-14(16-10-4-5-11-16)15(17)13-8-6-12(2)7-9-13;/h6-9,14H,3-5,10-11H2,1-2H3;1H/i4D2,5D2,10D2,11D2; |
| InChIKey | KGZQAHAZFKZPTL-FNVMJRNMSA-N |
| XLogP | 3.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.85 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |