C6H3F11O — CID 11522280
1,1,1,3,3,3-hexafluoro-2-(1,1,3,3,3-pentafluoropropoxy)propane (PubChem CID 11522280) has the molecular formula C6H3F11O and a molecular weight of 300.07 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(1,1,3,3,3-pentafluoropropoxy)propane.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(1,1,3,3,3-pentafluoropropoxy)propane |
|---|---|
| PubChem CID | 11522280 |
| Molecular Formula | C6H3F11O |
| Molecular Weight | 300.07 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(1,1,3,3,3-pentafluoropropoxy)propane |
| SMILES | FC(F)(F)CC(F)(F)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H3F11O/c7-3(8,9)1-4(10,11)18-2(5(12,13)14)6(15,16)17/h2H,1H2 |
| InChIKey | BHOHYIXCCDOACD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.07 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |